About 4,5-bis(ethenyl)-6-methyltriazine;ethane
4,5-bis(ethenyl)-6-methyltriazine;ethane (PubChem CID 142166070) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-6-methyltriazine;ethane.
Molecular Properties
| Compound Name | 4,5-bis(ethenyl)-6-methyltriazine;ethane |
| PubChem CID | 142166070 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 4,5-bis(ethenyl)-6-methyltriazine;ethane |
| SMILES | C=Cc1nnnc(C)c1C=C.CC |
| InChI | InChI=1S/C8H9N3.C2H6/c1-4-7-6(3)9-11-10-8(7)5-2;1-2/h4-5H,1-2H2,3H3;1-2H3 |
| InChIKey | FSKACJSQBOAROH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-bis(ethenyl)-6-methyltriazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-6-methyltriazine;ethane?
The IUPAC name of 4,5-bis(ethenyl)-6-methyltriazine;ethane (CID 142166070) is 4,5-bis(ethenyl)-6-methyltriazine;ethane.
What is the SMILES notation for 4,5-bis(ethenyl)-6-methyltriazine;ethane?
The canonical SMILES for 4,5-bis(ethenyl)-6-methyltriazine;ethane is C=Cc1nnnc(C)c1C=C.CC.
What is the InChIKey of 4,5-bis(ethenyl)-6-methyltriazine;ethane?
The InChIKey is FSKACJSQBOAROH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.C2H6/c1-4-7-6(3)9-11-10-8(7)5-2;1-2/h4-5H,1-2H2,3H3;1-2H3.
What are the key properties of 4,5-bis(ethenyl)-6-methyltriazine;ethane?
4,5-bis(ethenyl)-6-methyltriazine;ethane has a molecular weight of 177.25 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-6-methyltriazine;ethane is sourced from PubChem (CID 142166070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).