C15H18OS2 — CID 142166377
O-[(1E,3Z)-hexa-1,3,5-trienyl] [(4Z)-3-methylidenehepta-4,6-dien-2-yl]sulfanylmethanethioate (PubChem CID 142166377) has the molecular formula C15H18OS2 and a molecular weight of 278.44 g/mol. Its IUPAC name is O-[(1E,3Z)-hexa-1,3,5-trienyl] [(4Z)-3-methylidenehepta-4,6-dien-2-yl]sulfanylmethanethioate.
| Compound Name | O-[(1E,3Z)-hexa-1,3,5-trienyl] [(4Z)-3-methylidenehepta-4,6-dien-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 142166377 |
| Molecular Formula | C15H18OS2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | O-[(1E,3Z)-hexa-1,3,5-trienyl] [(4Z)-3-methylidenehepta-4,6-dien-2-yl]sulfanylmethanethioate |
| SMILES | C=C/C=C\C=C\OC(=S)SC(C)C(=C)/C=C\C=C |
| InChI | InChI=1S/C15H18OS2/c1-5-7-9-10-12-16-15(17)18-14(4)13(3)11-8-6-2/h5-12,14H,1-3H2,4H3/b9-7-,11-8-,12-10+ |
| InChIKey | CXUIIBSJGLPVMR-ORVHFSEBSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|