C15H23N — CID 142166657
N-[(3Z,5Z,7Z)-5-(2-methylbutan-2-yl)nona-1,3,5,7-tetraen-4-yl]methanimine (PubChem CID 142166657) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is N-[(3Z,5Z,7Z)-5-(2-methylbutan-2-yl)nona-1,3,5,7-tetraen-4-yl]methanimine.
| Compound Name | N-[(3Z,5Z,7Z)-5-(2-methylbutan-2-yl)nona-1,3,5,7-tetraen-4-yl]methanimine |
|---|---|
| PubChem CID | 142166657 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-[(3Z,5Z,7Z)-5-(2-methylbutan-2-yl)nona-1,3,5,7-tetraen-4-yl]methanimine |
| SMILES | C=C/C=C(N=C)/C(=C\C=C/C)C(C)(C)CC |
| InChI | InChI=1S/C15H23N/c1-7-10-12-13(15(4,5)9-3)14(16-6)11-8-2/h7-8,10-12H,2,6,9H2,1,3-5H3/b10-7-,13-12+,14-11- |
| InChIKey | RVWYMJLESPFYIZ-FNPJRJDVSA-N |
| XLogP | 4.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|