About 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine
4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine (PubChem CID 142166665) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine |
| PubChem CID | 142166665 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine |
| SMILES | C/C=C\C(C)=C/c1cn[nH]c1N |
| InChI | InChI=1S/C9H13N3/c1-3-4-7(2)5-8-6-11-12-9(8)10/h3-6H,1-2H3,(H3,10,11,12)/b4-3-,7-5- |
| InChIKey | IRJOLAVTCRFTPE-MRWCJKGFSA-N |
| XLogP | 1.97 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine?
The IUPAC name of 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine (CID 142166665) is 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine.
What is the SMILES notation for 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine?
The canonical SMILES for 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine is C/C=C\C(C)=C/c1cn[nH]c1N.
What is the InChIKey of 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine?
The InChIKey is IRJOLAVTCRFTPE-MRWCJKGFSA-N. The full InChI is InChI=1S/C9H13N3/c1-3-4-7(2)5-8-6-11-12-9(8)10/h3-6H,1-2H3,(H3,10,11,12)/b4-3-,7-5-.
What are the key properties of 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine?
4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine has a molecular weight of 163.22 g/mol, XLogP of 1.97, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z,3Z)-2-methylpenta-1,3-dienyl]-1H-pyrazol-5-amine is sourced from PubChem (CID 142166665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).