About (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide
(2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide (PubChem CID 142166721) has the molecular formula C9H13FN2
and a molecular weight of 168.21 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide.
Molecular Properties
| Compound Name | (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide |
| PubChem CID | 142166721 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide |
| SMILES | [H]/N=C(N)/C(/C=C(/C)C=C)=C(/C)F |
| InChI | InChI=1S/C9H13FN2/c1-4-6(2)5-8(7(3)10)9(11)12/h4-5H,1H2,2-3H3,(H3,11,12)/b6-5-,8-7- |
| InChIKey | AZDJXVJHSRMWQW-ISTTXYCBSA-N |
| XLogP | 2.30 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide?
The IUPAC name of (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide (CID 142166721) is (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide.
What is the SMILES notation for (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide?
The canonical SMILES for (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide is [H]/N=C(N)/C(/C=C(/C)C=C)=C(/C)F.
What is the InChIKey of (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide?
The InChIKey is AZDJXVJHSRMWQW-ISTTXYCBSA-N. The full InChI is InChI=1S/C9H13FN2/c1-4-6(2)5-8(7(3)10)9(11)12/h4-5H,1H2,2-3H3,(H3,11,12)/b6-5-,8-7-.
What are the key properties of (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide?
(2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide has a molecular weight of 168.21 g/mol, XLogP of 2.30, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,3Z)-2-(1-fluoroethylidene)-4-methylhexa-3,5-dienimidamide is sourced from PubChem (CID 142166721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).