About N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide
N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide (PubChem CID 142167091) has the molecular formula C8H7BrF3NOS
and a molecular weight of 302.12 g/mol. Its IUPAC name is N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide |
| PubChem CID | 142167091 |
| Molecular Formula | C8H7BrF3NOS |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.94 |
| IUPAC Name | N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide |
| SMILES | O=S(CC(F)(F)F)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H7BrF3NOS/c9-6-1-3-7(4-2-6)13-15(14)5-8(10,11)12/h1-4,13H,5H2 |
| InChIKey | VJUQFHFGKBFPKG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide?
The IUPAC name of N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide (CID 142167091) is N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide.
What is the SMILES notation for N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide?
The canonical SMILES for N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide is O=S(CC(F)(F)F)Nc1ccc(Br)cc1.
What is the InChIKey of N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide?
The InChIKey is VJUQFHFGKBFPKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrF3NOS/c9-6-1-3-7(4-2-6)13-15(14)5-8(10,11)12/h1-4,13H,5H2.
What are the key properties of N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide?
N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide has a molecular weight of 302.12 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-2,2,2-trifluoroethanesulfinamide is sourced from PubChem (CID 142167091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).