About 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol
1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol (PubChem CID 142167131) has the molecular formula C22H30O4S
and a molecular weight of 390.55 g/mol. Its IUPAC name is 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol.
Molecular Properties
| Compound Name | 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol |
| PubChem CID | 142167131 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol |
| SMILES | CCCO.CCOc1cc(-c2cccc(CS(=O)CC(C)=O)c2)ccc1C |
| InChI | InChI=1S/C19H22O3S.C3H8O/c1-4-22-19-11-18(9-8-14(19)2)17-7-5-6-16(10-17)13-23(21)12-15(3)20;1-2-3-4/h5-11H,4,12-13H2,1-3H3;4H,2-3H2,1H3 |
| InChIKey | XEBZNDBOOLGCAU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol?
The IUPAC name of 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol (CID 142167131) is 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol.
What is the SMILES notation for 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol?
The canonical SMILES for 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol is CCCO.CCOc1cc(-c2cccc(CS(=O)CC(C)=O)c2)ccc1C.
What is the InChIKey of 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol?
The InChIKey is XEBZNDBOOLGCAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3S.C3H8O/c1-4-22-19-11-18(9-8-14(19)2)17-7-5-6-16(10-17)13-23(21)12-15(3)20;1-2-3-4/h5-11H,4,12-13H2,1-3H3;4H,2-3H2,1H3.
What are the key properties of 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol?
1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol has a molecular weight of 390.55 g/mol, XLogP of 4.29, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(3-ethoxy-4-methylphenyl)phenyl]methylsulfinyl]propan-2-one;propan-1-ol is sourced from PubChem (CID 142167131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).