About N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine
N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine (PubChem CID 142167499) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine.
Molecular Properties
| Compound Name | N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine |
| PubChem CID | 142167499 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine |
| SMILES | C/N=C/C=N/C=C(C)C |
| InChI | InChI=1S/C7H12N2/c1-7(2)6-9-5-4-8-3/h4-6H,1-3H3/b8-4+,9-5+ |
| InChIKey | YOVICDIHFOTTOP-KBXRYBNXSA-N |
| XLogP | 1.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine?
The IUPAC name of N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine (CID 142167499) is N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine.
What is the SMILES notation for N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine?
The canonical SMILES for N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine is C/N=C/C=N/C=C(C)C.
What is the InChIKey of N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine?
The InChIKey is YOVICDIHFOTTOP-KBXRYBNXSA-N. The full InChI is InChI=1S/C7H12N2/c1-7(2)6-9-5-4-8-3/h4-6H,1-3H3/b8-4+,9-5+.
What are the key properties of N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine?
N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine has a molecular weight of 124.19 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-(2-methylprop-1-enyl)ethane-1,2-diimine is sourced from PubChem (CID 142167499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).