About 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one
6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one (PubChem CID 142168649) has the molecular formula C21H22N4O3
and a molecular weight of 378.43 g/mol. Its IUPAC name is 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one |
| PubChem CID | 142168649 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one |
| SMILES | Cc1cccc(-c2c(-c3ccc4c(c3)[nH]c(=O)n4C)cnn2CC(C)(O)O)c1 |
| InChI | InChI=1S/C21H22N4O3/c1-13-5-4-6-15(9-13)19-16(11-22-25(19)12-21(2,27)28)14-7-8-18-17(10-14)23-20(26)24(18)3/h4-11,27-28H,12H2,1-3H3,(H,23,26) |
| InChIKey | GMVYXRAMFZHMRU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one?
The IUPAC name of 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one (CID 142168649) is 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one.
What is the SMILES notation for 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one?
The canonical SMILES for 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one is Cc1cccc(-c2c(-c3ccc4c(c3)[nH]c(=O)n4C)cnn2CC(C)(O)O)c1.
What is the InChIKey of 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one?
The InChIKey is GMVYXRAMFZHMRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O3/c1-13-5-4-6-15(9-13)19-16(11-22-25(19)12-21(2,27)28)14-7-8-18-17(10-14)23-20(26)24(18)3/h4-11,27-28H,12H2,1-3H3,(H,23,26).
What are the key properties of 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one?
6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one has a molecular weight of 378.43 g/mol, XLogP of 2.41, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(2,2-dihydroxypropyl)-5-(3-methylphenyl)pyrazol-4-yl]-3-methyl-1H-benzimidazol-2-one is sourced from PubChem (CID 142168649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).