C25H31N5O — CID 142168745
5-[3-(butylamino)-5-(3-methylphenyl)-1H-pyrazol-4-yl]-1,3-diethylbenzimidazol-2-one (PubChem CID 142168745) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 5-[3-(butylamino)-5-(3-methylphenyl)-1H-pyrazol-4-yl]-1,3-diethylbenzimidazol-2-one.
| Compound Name | 5-[3-(butylamino)-5-(3-methylphenyl)-1H-pyrazol-4-yl]-1,3-diethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 142168745 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 5-[3-(butylamino)-5-(3-methylphenyl)-1H-pyrazol-4-yl]-1,3-diethylbenzimidazol-2-one |
| SMILES | CCCCNc1n[nH]c(-c2cccc(C)c2)c1-c1ccc2c(c1)n(CC)c(=O)n2CC |
| InChI | InChI=1S/C25H31N5O/c1-5-8-14-26-24-22(23(27-28-24)19-11-9-10-17(4)15-19)18-12-13-20-21(16-18)30(7-3)25(31)29(20)6-2/h9-13,15-16H,5-8,14H2,1-4H3,(H2,26,27,28) |
| InChIKey | JRTNDEAWTUPGNJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|