C28H32F2N2O2 — CID 142168933
(Z)-3-[[4-[[1-(3,4-difluorophenyl)ethylamino]-(5-methoxycyclohepta-1,4,6-trien-1-yl)methyl]cyclohepta-1,4,6-trien-1-yl]amino]but-2-en-2-ol (PubChem CID 142168933) has the molecular formula C28H32F2N2O2 and a molecular weight of 466.57 g/mol. Its IUPAC name is (Z)-3-[[4-[[1-(3,4-difluorophenyl)ethylamino]-(5-methoxycyclohepta-1,4,6-trien-1-yl)methyl]cyclohepta-1,4,6-trien-1-yl]amino]but-2-en-2-ol.
| Compound Name | (Z)-3-[[4-[[1-(3,4-difluorophenyl)ethylamino]-(5-methoxycyclohepta-1,4,6-trien-1-yl)methyl]cyclohepta-1,4,6-trien-1-yl]amino]but-2-en-2-ol |
|---|---|
| PubChem CID | 142168933 |
| Molecular Formula | C28H32F2N2O2 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (Z)-3-[[4-[[1-(3,4-difluorophenyl)ethylamino]-(5-methoxycyclohepta-1,4,6-trien-1-yl)methyl]cyclohepta-1,4,6-trien-1-yl]amino]but-2-en-2-ol |
| SMILES | COC1=CCC=C(C(NC(C)c2ccc(F)c(F)c2)C2=CC=CC(N/C(C)=C(/C)O)=CC2)C=C1 |
| InChI | InChI=1S/C28H32F2N2O2/c1-18(20(3)33)31-24-9-5-7-21(11-14-24)28(22-8-6-10-25(34-4)15-12-22)32-19(2)23-13-16-26(29)27(30)17-23/h5,7-10,12-17,19,28,31-33H,6,11H2,1-4H3/b20-18- |
| InChIKey | KTIITPDDJJGJRK-ZZEZOPTASA-N |
| XLogP | 6.57 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|