C18H18F6N2O4 — CID 142168995
ethyl acetate;1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one (PubChem CID 142168995) has the molecular formula C18H18F6N2O4 and a molecular weight of 440.34 g/mol. Its IUPAC name is ethyl acetate;1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one.
| Compound Name | ethyl acetate;1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one |
|---|---|
| PubChem CID | 142168995 |
| Molecular Formula | C18H18F6N2O4 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | ethyl acetate;1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one |
| SMILES | CCOC(C)=O.O=c1cc(C(F)(F)F)c2cc3c(cc2[nH]1)OCCN3CC(F)(F)F |
| InChI | InChI=1S/C14H10F6N2O2.C4H8O2/c15-13(16,17)6-22-1-2-24-11-5-9-7(3-10(11)22)8(14(18,19)20)4-12(23)21-9;1-3-6-4(2)5/h3-5H,1-2,6H2,(H,21,23);3H2,1-2H3 |
| InChIKey | NYDZEQHLCNNHJC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |