About butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine
butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine (PubChem CID 142169641) has the molecular formula C25H45N
and a molecular weight of 359.64 g/mol. Its IUPAC name is butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine.
Molecular Properties
| Compound Name | butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine |
| PubChem CID | 142169641 |
| Molecular Formula | C25H45N |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 359.36 |
| IUPAC Name | butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine |
| SMILES | C=C/C=C(\C=C/C)CN1CCC(C(=CCC)CCCC)CC1.CCCC |
| InChI | InChI=1S/C21H35N.C4H10/c1-5-9-13-20(12-8-4)21-14-16-22(17-15-21)18-19(10-6-2)11-7-3;1-3-4-2/h6-7,10-12,21H,2,5,8-9,13-18H2,1,3-4H3;3-4H2,1-2H3/b11-7-,19-10+,20-12?; |
| InChIKey | KJCBNYPCBZXVSN-AQJQWIIFSA-N |
| XLogP | 7.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine?
The IUPAC name of butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine (CID 142169641) is butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine.
What is the SMILES notation for butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine?
The canonical SMILES for butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine is C=C/C=C(\C=C/C)CN1CCC(C(=CCC)CCCC)CC1.CCCC.
What is the InChIKey of butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine?
The InChIKey is KJCBNYPCBZXVSN-AQJQWIIFSA-N. The full InChI is InChI=1S/C21H35N.C4H10/c1-5-9-13-20(12-8-4)21-14-16-22(17-15-21)18-19(10-6-2)11-7-3;1-3-4-2/h6-7,10-12,21H,2,5,8-9,13-18H2,1,3-4H3;3-4H2,1-2H3/b11-7-,19-10+,20-12?;.
What are the key properties of butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine?
butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine has a molecular weight of 359.64 g/mol, XLogP of 7.72, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;4-oct-3-en-4-yl-1-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidine is sourced from PubChem (CID 142169641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).