C14H20O4 — CID 142169798
2-(butoxymethyl)-2,3,7,8-tetrahydro-1,4-benzodioxine-7-carbaldehyde (PubChem CID 142169798) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(butoxymethyl)-2,3,7,8-tetrahydro-1,4-benzodioxine-7-carbaldehyde.
| Compound Name | 2-(butoxymethyl)-2,3,7,8-tetrahydro-1,4-benzodioxine-7-carbaldehyde |
|---|---|
| PubChem CID | 142169798 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(butoxymethyl)-2,3,7,8-tetrahydro-1,4-benzodioxine-7-carbaldehyde |
| SMILES | CCCCOCC1COC2=C(CC(C=O)C=C2)O1 |
| InChI | InChI=1S/C14H20O4/c1-2-3-6-16-9-12-10-17-13-5-4-11(8-15)7-14(13)18-12/h4-5,8,11-12H,2-3,6-7,9-10H2,1H3 |
| InChIKey | VDFFXNZNXVDCJO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|