About (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide
(3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide (PubChem CID 142170596) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide.
Molecular Properties
| Compound Name | (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide |
| PubChem CID | 142170596 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide |
| SMILES | C=C(/C=C\C(C)=C(C)C)C(=O)NC=O |
| InChI | InChI=1S/C11H15NO2/c1-8(2)9(3)5-6-10(4)11(14)12-7-13/h5-7H,4H2,1-3H3,(H,12,13,14)/b6-5- |
| InChIKey | CKLSBFGXRFKEKV-WAYWQWQTSA-N |
| XLogP | 1.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide?
The IUPAC name of (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide (CID 142170596) is (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide.
What is the SMILES notation for (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide?
The canonical SMILES for (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide is C=C(/C=C\C(C)=C(C)C)C(=O)NC=O.
What is the InChIKey of (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide?
The InChIKey is CKLSBFGXRFKEKV-WAYWQWQTSA-N. The full InChI is InChI=1S/C11H15NO2/c1-8(2)9(3)5-6-10(4)11(14)12-7-13/h5-7H,4H2,1-3H3,(H,12,13,14)/b6-5-.
What are the key properties of (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide?
(3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide has a molecular weight of 193.25 g/mol, XLogP of 1.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-formyl-5,6-dimethyl-2-methylidenehepta-3,5-dienamide is sourced from PubChem (CID 142170596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).