About 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile
2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile (PubChem CID 142170610) has the molecular formula C9H12NP
and a molecular weight of 165.18 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile |
| PubChem CID | 142170610 |
| Molecular Formula | C9H12NP |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile |
| SMILES | CC1=C(C)PC(CC#N)C=C1 |
| InChI | InChI=1S/C9H12NP/c1-7-3-4-9(5-6-10)11-8(7)2/h3-4,9,11H,5H2,1-2H3 |
| InChIKey | AGJMINSWFHZBKH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile?
The IUPAC name of 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile (CID 142170610) is 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile.
What is the SMILES notation for 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile?
The canonical SMILES for 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile is CC1=C(C)PC(CC#N)C=C1.
What is the InChIKey of 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile?
The InChIKey is AGJMINSWFHZBKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12NP/c1-7-3-4-9(5-6-10)11-8(7)2/h3-4,9,11H,5H2,1-2H3.
What are the key properties of 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile?
2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile has a molecular weight of 165.18 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethyl-1,2-dihydrophosphinin-2-yl)acetonitrile is sourced from PubChem (CID 142170610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).