C13H21BN4O2 — CID 142171069
[(2Z,5Z)-7-(2-tert-butyltetrazol-5-yl)octa-2,5,7-trien-3-yl]boronic acid (PubChem CID 142171069) has the molecular formula C13H21BN4O2 and a molecular weight of 276.15 g/mol. Its IUPAC name is [(2Z,5Z)-7-(2-tert-butyltetrazol-5-yl)octa-2,5,7-trien-3-yl]boronic acid.
| Compound Name | [(2Z,5Z)-7-(2-tert-butyltetrazol-5-yl)octa-2,5,7-trien-3-yl]boronic acid |
|---|---|
| PubChem CID | 142171069 |
| Molecular Formula | C13H21BN4O2 |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | [(2Z,5Z)-7-(2-tert-butyltetrazol-5-yl)octa-2,5,7-trien-3-yl]boronic acid |
| SMILES | C=C(/C=C\C/C(=C\C)B(O)O)c1nnn(C(C)(C)C)n1 |
| InChI | InChI=1S/C13H21BN4O2/c1-6-11(14(19)20)9-7-8-10(2)12-15-17-18(16-12)13(3,4)5/h6-8,19-20H,2,9H2,1,3-5H3/b8-7-,11-6+ |
| InChIKey | NEADGIFSJMMVMQ-YKFSIMETSA-N |
| XLogP | 1.35 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|