C18H27N — CID 142171222
ethene;(4E,5E)-4-ethylidene-N,N,6-trimethyl-7-methylidenedeca-5,9-dien-2-yn-1-amine (PubChem CID 142171222) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is ethene;(4E,5E)-4-ethylidene-N,N,6-trimethyl-7-methylidenedeca-5,9-dien-2-yn-1-amine.
| Compound Name | ethene;(4E,5E)-4-ethylidene-N,N,6-trimethyl-7-methylidenedeca-5,9-dien-2-yn-1-amine |
|---|---|
| PubChem CID | 142171222 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | ethene;(4E,5E)-4-ethylidene-N,N,6-trimethyl-7-methylidenedeca-5,9-dien-2-yn-1-amine |
| SMILES | C=C.C=CCC(=C)/C(C)=C/C(C#CCN(C)C)=C\C |
| InChI | InChI=1S/C16H23N.C2H4/c1-7-10-14(3)15(4)13-16(8-2)11-9-12-17(5)6;1-2/h7-8,13H,1,3,10,12H2,2,4-6H3;1-2H2/b15-13+,16-8-; |
| InChIKey | LRMQTMIJVKHVMQ-RZHHJBTKSA-N |
| XLogP | 4.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|