About 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane
1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane (PubChem CID 142171532) has the molecular formula C16H26N2O3
and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane |
| PubChem CID | 142171532 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane |
| SMILES | CC.NC1=CCCCC(C(=O)N2CCCCC2C(=O)O)=C1 |
| InChI | InChI=1S/C14H20N2O3.C2H6/c15-11-6-2-1-5-10(9-11)13(17)16-8-4-3-7-12(16)14(18)19;1-2/h6,9,12H,1-5,7-8,15H2,(H,18,19);1-2H3 |
| InChIKey | OZNFSDKNAVUCIT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane?
The IUPAC name of 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane (CID 142171532) is 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane.
What is the SMILES notation for 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane?
The canonical SMILES for 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane is CC.NC1=CCCCC(C(=O)N2CCCCC2C(=O)O)=C1.
What is the InChIKey of 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane?
The InChIKey is OZNFSDKNAVUCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3.C2H6/c15-11-6-2-1-5-10(9-11)13(17)16-8-4-3-7-12(16)14(18)19;1-2/h6,9,12H,1-5,7-8,15H2,(H,18,19);1-2H3.
What are the key properties of 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane?
1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane has a molecular weight of 294.39 g/mol, XLogP of 2.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminocyclohepta-1,3-diene-1-carbonyl)piperidine-2-carboxylic acid;ethane is sourced from PubChem (CID 142171532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).