C22H39N3O — CID 142171824
N-[1-[4-(1-ethylpiperidin-3-yl)oxyphenyl]ethyl]-N',N'-dimethylethane-1,2-diamine;prop-1-ene (PubChem CID 142171824) has the molecular formula C22H39N3O and a molecular weight of 361.57 g/mol. Its IUPAC name is N-[1-[4-(1-ethylpiperidin-3-yl)oxyphenyl]ethyl]-N',N'-dimethylethane-1,2-diamine;prop-1-ene.
| Compound Name | N-[1-[4-(1-ethylpiperidin-3-yl)oxyphenyl]ethyl]-N',N'-dimethylethane-1,2-diamine;prop-1-ene |
|---|---|
| PubChem CID | 142171824 |
| Molecular Formula | C22H39N3O |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.31 |
| IUPAC Name | N-[1-[4-(1-ethylpiperidin-3-yl)oxyphenyl]ethyl]-N',N'-dimethylethane-1,2-diamine;prop-1-ene |
| SMILES | C=CC.CCN1CCCC(Oc2ccc(C(C)NCCN(C)C)cc2)C1 |
| InChI | InChI=1S/C19H33N3O.C3H6/c1-5-22-13-6-7-19(15-22)23-18-10-8-17(9-11-18)16(2)20-12-14-21(3)4;1-3-2/h8-11,16,19-20H,5-7,12-15H2,1-4H3;3H,1H2,2H3 |
| InChIKey | DTKMNMFKJDTLSY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|