C16H29Cl2N3O — CID 142172202
2-[(2E,4E)-3,4-dichlorohexa-2,4-dienyl]-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine (PubChem CID 142172202) has the molecular formula C16H29Cl2N3O and a molecular weight of 350.33 g/mol. Its IUPAC name is 2-[(2E,4E)-3,4-dichlorohexa-2,4-dienyl]-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine.
| Compound Name | 2-[(2E,4E)-3,4-dichlorohexa-2,4-dienyl]-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 142172202 |
| Molecular Formula | C16H29Cl2N3O |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-[(2E,4E)-3,4-dichlorohexa-2,4-dienyl]-N'-(2-morpholin-4-ylethyl)butane-1,4-diamine |
| SMILES | C/C=C(Cl)\C(Cl)=C/CC(CN)CCNCCN1CCOCC1 |
| InChI | InChI=1S/C16H29Cl2N3O/c1-2-15(17)16(18)4-3-14(13-19)5-6-20-7-8-21-9-11-22-12-10-21/h2,4,14,20H,3,5-13,19H2,1H3/b15-2+,16-4+ |
| InChIKey | DWLMHULOAOIINI-CGGHQIHQSA-N |
| XLogP | 2.53 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|