C18H33F2N — CID 142172211
2-[4-(3,4-difluorocyclohexyl)cyclohexyl]-N-propylpropan-1-amine (PubChem CID 142172211) has the molecular formula C18H33F2N and a molecular weight of 301.47 g/mol. Its IUPAC name is 2-[4-(3,4-difluorocyclohexyl)cyclohexyl]-N-propylpropan-1-amine.
| Compound Name | 2-[4-(3,4-difluorocyclohexyl)cyclohexyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 142172211 |
| Molecular Formula | C18H33F2N |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | 2-[4-(3,4-difluorocyclohexyl)cyclohexyl]-N-propylpropan-1-amine |
| SMILES | CCCNCC(C)C1CCC(C2CCC(F)C(F)C2)CC1 |
| InChI | InChI=1S/C18H33F2N/c1-3-10-21-12-13(2)14-4-6-15(7-5-14)16-8-9-17(19)18(20)11-16/h13-18,21H,3-12H2,1-2H3 |
| InChIKey | DSVPESAWWHPOMF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|