About (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane
(3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane (PubChem CID 142172277) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane.
Molecular Properties
| Compound Name | (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane |
| PubChem CID | 142172277 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane |
| SMILES | C=C/C(=C\C=C/C)C(C#N)CCN(C)C.CC |
| InChI | InChI=1S/C13H20N2.C2H6/c1-5-7-8-12(6-2)13(11-14)9-10-15(3)4;1-2/h5-8,13H,2,9-10H2,1,3-4H3;1-2H3/b7-5-,12-8+; |
| InChIKey | GYEXLFQQBOMUIM-LOLBUNACSA-N |
| XLogP | 3.79 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane?
The IUPAC name of (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane (CID 142172277) is (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane.
What is the SMILES notation for (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane?
The canonical SMILES for (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane is C=C/C(=C\C=C/C)C(C#N)CCN(C)C.CC.
What is the InChIKey of (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane?
The InChIKey is GYEXLFQQBOMUIM-LOLBUNACSA-N. The full InChI is InChI=1S/C13H20N2.C2H6/c1-5-7-8-12(6-2)13(11-14)9-10-15(3)4;1-2/h5-8,13H,2,9-10H2,1,3-4H3;1-2H3/b7-5-,12-8+;.
What are the key properties of (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane?
(3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane has a molecular weight of 234.39 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-2-[2-(dimethylamino)ethyl]-3-ethenylhepta-3,5-dienenitrile;ethane is sourced from PubChem (CID 142172277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).