C23H21FN6O2 — CID 142172422
2-N-(4-fluorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine;1H-indazole (PubChem CID 142172422) has the molecular formula C23H21FN6O2 and a molecular weight of 432.46 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine;1H-indazole.
| Compound Name | 2-N-(4-fluorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine;1H-indazole |
|---|---|
| PubChem CID | 142172422 |
| Molecular Formula | C23H21FN6O2 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-N-(4-fluorophenyl)-6,7-dimethoxyquinazoline-2,4-diamine;1H-indazole |
| SMILES | COc1cc2nc(Nc3ccc(F)cc3)nc(N)c2cc1OC.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C16H15FN4O2.C7H6N2/c1-22-13-7-11-12(8-14(13)23-2)20-16(21-15(11)18)19-10-5-3-9(17)4-6-10;1-2-4-7-6(3-1)5-8-9-7/h3-8H,1-2H3,(H3,18,19,20,21);1-5H,(H,8,9) |
| InChIKey | QWAIIUYCCIJLNV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |