C14H23NO — CID 142172425
[4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]piperidin-3-yl]methanol (PubChem CID 142172425) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is [4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]piperidin-3-yl]methanol.
| Compound Name | [4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 142172425 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | [4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]piperidin-3-yl]methanol |
| SMILES | C/C=C\C=C(/C=C\C)C1CCNCC1CO |
| InChI | InChI=1S/C14H23NO/c1-3-5-7-12(6-4-2)14-8-9-15-10-13(14)11-16/h3-7,13-16H,8-11H2,1-2H3/b5-3-,6-4-,12-7+ |
| InChIKey | AUHOMKPDUBDRPZ-WFYFVCBASA-N |
| XLogP | 2.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|