C13H21NO — CID 142172427
[(3R,4S)-4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]piperidin-3-yl]methanol (PubChem CID 142172427) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is [(3R,4S)-4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]piperidin-3-yl]methanol.
| Compound Name | [(3R,4S)-4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 142172427 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | [(3R,4S)-4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]piperidin-3-yl]methanol |
| SMILES | C=C/C=C\C=C(/C)[C@H]1CCNC[C@@H]1CO |
| InChI | InChI=1S/C13H21NO/c1-3-4-5-6-11(2)13-7-8-14-9-12(13)10-15/h3-6,12-15H,1,7-10H2,2H3/b5-4-,11-6+/t12-,13-/m1/s1 |
| InChIKey | KTGWKERIGMAKFX-GCQUGOGZSA-N |
| XLogP | 1.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|