C26H16F4N2O5S — CID 142172469
6,7,19,20-tetrafluoro-23-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]-3-thia-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 142172469) has the molecular formula C26H16F4N2O5S and a molecular weight of 544.48 g/mol. Its IUPAC name is 6,7,19,20-tetrafluoro-23-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]-3-thia-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 6,7,19,20-tetrafluoro-23-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]-3-thia-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 142172469 |
| Molecular Formula | C26H16F4N2O5S |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | 6,7,19,20-tetrafluoro-23-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]-3-thia-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3cc(F)c(F)cc3sc1c1c2c2cc(F)c(F)cc2n1C1CC(O)CC(CO)O1 |
| InChI | InChI=1S/C26H16F4N2O5S/c27-12-3-10-16(5-14(12)29)32(18-2-8(34)1-9(7-33)37-18)23-19(10)21-22(26(36)31-25(21)35)20-11-4-13(28)15(30)6-17(11)38-24(20)23/h3-6,8-9,18,33-34H,1-2,7H2,(H,31,35,36) |
| InChIKey | HTTXIESKWRXQKS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|