C12H25NS4 — CID 142172883
1,2,4,4,6-pentamethyl-2,6-bis(sulfanylmethyl)piperidine-3,3-dithiol (PubChem CID 142172883) has the molecular formula C12H25NS4 and a molecular weight of 311.61 g/mol. Its IUPAC name is 1,2,4,4,6-pentamethyl-2,6-bis(sulfanylmethyl)piperidine-3,3-dithiol.
| Compound Name | 1,2,4,4,6-pentamethyl-2,6-bis(sulfanylmethyl)piperidine-3,3-dithiol |
|---|---|
| PubChem CID | 142172883 |
| Molecular Formula | C12H25NS4 |
| Molecular Weight | 311.61 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1,2,4,4,6-pentamethyl-2,6-bis(sulfanylmethyl)piperidine-3,3-dithiol |
| SMILES | CN1C(C)(CS)CC(C)(C)C(S)(S)C1(C)CS |
| InChI | InChI=1S/C12H25NS4/c1-9(2)6-10(3,7-14)13(5)11(4,8-15)12(9,16)17/h14-17H,6-8H2,1-5H3 |
| InChIKey | HCJQCCCXAJYACD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|