About 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one
1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one (PubChem CID 142172933) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one |
| PubChem CID | 142172933 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one |
| SMILES | C=c1c(=C)n(C)c(=S)n(C)c1=O |
| InChI | InChI=1S/C8H10N2OS/c1-5-6(2)9(3)8(12)10(4)7(5)11/h1-2H2,3-4H3 |
| InChIKey | STKIZVBZWFAMPO-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one?
The IUPAC name of 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one (CID 142172933) is 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one.
What is the SMILES notation for 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one?
The canonical SMILES for 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one is C=c1c(=C)n(C)c(=S)n(C)c1=O.
What is the InChIKey of 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one?
The InChIKey is STKIZVBZWFAMPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-5-6(2)9(3)8(12)10(4)7(5)11/h1-2H2,3-4H3.
What are the key properties of 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one?
1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one has a molecular weight of 182.25 g/mol, XLogP of -0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5,6-dimethylidene-2-sulfanylidene-1,3-diazinan-4-one is sourced from PubChem (CID 142172933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).