C22H20N4O2S — CID 142173138
2-amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(2E,4Z)-hepta-2,4-dien-3-yl]sulfanylpyridine-3,5-dicarbonitrile (PubChem CID 142173138) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(2E,4Z)-hepta-2,4-dien-3-yl]sulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(2E,4Z)-hepta-2,4-dien-3-yl]sulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 142173138 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(2E,4Z)-hepta-2,4-dien-3-yl]sulfanylpyridine-3,5-dicarbonitrile |
| SMILES | C/C=C(\C=C/CC)Sc1nc(N)c(C#N)c(-c2ccc3c(c2)OCCO3)c1C#N |
| InChI | InChI=1S/C22H20N4O2S/c1-3-5-6-15(4-2)29-22-17(13-24)20(16(12-23)21(25)26-22)14-7-8-18-19(11-14)28-10-9-27-18/h4-8,11H,3,9-10H2,1-2H3,(H2,25,26)/b6-5-,15-4+ |
| InChIKey | DJVQZTMMJSJTKA-LFZRQRCSSA-N |
| XLogP | 4.81 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|