About acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane
acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane (PubChem CID 142174123) has the molecular formula C28H51N
and a molecular weight of 401.72 g/mol. Its IUPAC name is acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane.
Molecular Properties
| Compound Name | acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane |
| PubChem CID | 142174123 |
| Molecular Formula | C28H51N |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 401.40 |
| IUPAC Name | acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane |
| SMILES | C#C.CCCCC.CCCCNC[C@@H](CCC(CCC)CCC)c1ccccc1 |
| InChI | InChI=1S/C21H37N.C5H12.C2H2/c1-4-7-17-22-18-21(20-13-9-8-10-14-20)16-15-19(11-5-2)12-6-3;1-3-5-4-2;1-2/h8-10,13-14,19,21-22H,4-7,11-12,15-18H2,1-3H3;3-5H2,1-2H3;1-2H/t21-;;/m1../s1 |
| InChIKey | RQIHUORGMCNNKN-GHVWMZMZSA-N |
| XLogP | 8.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane?
The IUPAC name of acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane (CID 142174123) is acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane.
What is the SMILES notation for acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane?
The canonical SMILES for acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane is C#C.CCCCC.CCCCNC[C@@H](CCC(CCC)CCC)c1ccccc1.
What is the InChIKey of acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane?
The InChIKey is RQIHUORGMCNNKN-GHVWMZMZSA-N. The full InChI is InChI=1S/C21H37N.C5H12.C2H2/c1-4-7-17-22-18-21(20-13-9-8-10-14-20)16-15-19(11-5-2)12-6-3;1-3-5-4-2;1-2/h8-10,13-14,19,21-22H,4-7,11-12,15-18H2,1-3H3;3-5H2,1-2H3;1-2H/t21-;;/m1../s1.
What are the key properties of acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane?
acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane has a molecular weight of 401.72 g/mol, XLogP of 8.60, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(2S)-N-butyl-2-phenyl-5-propyloctan-1-amine;pentane is sourced from PubChem (CID 142174123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).