About acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine
acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine (PubChem CID 142174161) has the molecular formula C23H25F3N2
and a molecular weight of 386.46 g/mol. Its IUPAC name is acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine.
Molecular Properties
| Compound Name | acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine |
| PubChem CID | 142174161 |
| Molecular Formula | C23H25F3N2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine |
| SMILES | C#C.CN(C)Cc1ccccc1.FC(F)(F)c1ccc2c(C3CC3)c[nH]c2c1 |
| InChI | InChI=1S/C12H10F3N.C9H13N.C2H2/c13-12(14,15)8-3-4-9-10(7-1-2-7)6-16-11(9)5-8;1-10(2)8-9-6-4-3-5-7-9;1-2/h3-7,16H,1-2H2;3-7H,8H2,1-2H3;1-2H |
| InChIKey | CVOUFRGGGJOILY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine?
The IUPAC name of acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine (CID 142174161) is acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine.
What is the SMILES notation for acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine?
The canonical SMILES for acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine is C#C.CN(C)Cc1ccccc1.FC(F)(F)c1ccc2c(C3CC3)c[nH]c2c1.
What is the InChIKey of acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine?
The InChIKey is CVOUFRGGGJOILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N.C9H13N.C2H2/c13-12(14,15)8-3-4-9-10(7-1-2-7)6-16-11(9)5-8;1-10(2)8-9-6-4-3-5-7-9;1-2/h3-7,16H,1-2H2;3-7H,8H2,1-2H3;1-2H.
What are the key properties of acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine?
acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine has a molecular weight of 386.46 g/mol, XLogP of 6.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;3-cyclopropyl-6-(trifluoromethyl)-1H-indole;N,N-dimethyl-1-phenylmethanamine is sourced from PubChem (CID 142174161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).