About 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione
2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione (PubChem CID 142174216) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione.
Molecular Properties
| Compound Name | 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione |
| PubChem CID | 142174216 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione |
| SMILES | [H]/N=C1\C(=O)C2=CC=CC3C2=C(C=CC3C)C1=O |
| InChI | InChI=1S/C14H11NO2/c1-7-5-6-10-11-8(7)3-2-4-9(11)13(16)12(15)14(10)17/h2-8,15H,1H3/b15-12+ |
| InChIKey | NDVUZSZYOBJHCA-NTCAYCPXSA-N |
| XLogP | 1.77 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione?
The IUPAC name of 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione (CID 142174216) is 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione.
What is the SMILES notation for 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione?
The canonical SMILES for 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione is [H]/N=C1\C(=O)C2=CC=CC3C2=C(C=CC3C)C1=O.
What is the InChIKey of 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione?
The InChIKey is NDVUZSZYOBJHCA-NTCAYCPXSA-N. The full InChI is InChI=1S/C14H11NO2/c1-7-5-6-10-11-8(7)3-2-4-9(11)13(16)12(15)14(10)17/h2-8,15H,1H3/b15-12+.
What are the key properties of 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione?
2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione has a molecular weight of 225.25 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-6-methyl-6,6a-dihydrophenalene-1,3-dione is sourced from PubChem (CID 142174216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).