C23H26FN3O — CID 142174320
3-[[4-[(2E,4Z,6Z)-1-(4-fluorophenyl)-1-imino-3-methylocta-2,4,6-trien-2-yl]-2-pyridinyl]amino]propan-1-ol (PubChem CID 142174320) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is 3-[[4-[(2E,4Z,6Z)-1-(4-fluorophenyl)-1-imino-3-methylocta-2,4,6-trien-2-yl]-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[4-[(2E,4Z,6Z)-1-(4-fluorophenyl)-1-imino-3-methylocta-2,4,6-trien-2-yl]-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 142174320 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 3-[[4-[(2E,4Z,6Z)-1-(4-fluorophenyl)-1-imino-3-methylocta-2,4,6-trien-2-yl]-2-pyridinyl]amino]propan-1-ol |
| SMILES | [H]/N=C(C(=C(C)/C=C\C=C/C)/c1ccnc(NCCCO)c1)\c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3O/c1-3-4-5-7-17(2)22(23(25)18-8-10-20(24)11-9-18)19-12-14-27-21(16-19)26-13-6-15-28/h3-5,7-12,14,16,25,28H,6,13,15H2,1-2H3,(H,26,27)/b4-3-,7-5-,22-17+,25-23+ |
| InChIKey | GJTGINWNYONJQK-AMGMCDAMSA-N |
| XLogP | 4.99 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|