C22H24FN3O — CID 142174330
2-[[4-[(2E,4Z,6Z)-1-(4-fluorophenyl)-1-imino-3-methylocta-2,4,6-trien-2-yl]-2-pyridinyl]amino]ethanol (PubChem CID 142174330) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is 2-[[4-[(2E,4Z,6Z)-1-(4-fluorophenyl)-1-imino-3-methylocta-2,4,6-trien-2-yl]-2-pyridinyl]amino]ethanol.
| Compound Name | 2-[[4-[(2E,4Z,6Z)-1-(4-fluorophenyl)-1-imino-3-methylocta-2,4,6-trien-2-yl]-2-pyridinyl]amino]ethanol |
|---|---|
| PubChem CID | 142174330 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[[4-[(2E,4Z,6Z)-1-(4-fluorophenyl)-1-imino-3-methylocta-2,4,6-trien-2-yl]-2-pyridinyl]amino]ethanol |
| SMILES | [H]/N=C(C(=C(C)/C=C\C=C/C)/c1ccnc(NCCO)c1)\c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN3O/c1-3-4-5-6-16(2)21(22(24)17-7-9-19(23)10-8-17)18-11-12-25-20(15-18)26-13-14-27/h3-12,15,24,27H,13-14H2,1-2H3,(H,25,26)/b4-3-,6-5-,21-16+,24-22+ |
| InChIKey | FYWWEQSLGXTLRI-ZDRVRWNCSA-N |
| XLogP | 4.60 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|