C12H19NO — CID 142175106
pyrrolidin-3-ol;1,2-xylene (PubChem CID 142175106) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is pyrrolidin-3-ol;1,2-xylene.
| Compound Name | pyrrolidin-3-ol;1,2-xylene |
|---|---|
| PubChem CID | 142175106 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | pyrrolidin-3-ol;1,2-xylene |
| SMILES | Cc1ccccc1C.OC1CCNC1 |
| InChI | InChI=1S/C8H10.C4H9NO/c1-7-5-3-4-6-8(7)2;6-4-1-2-5-3-4/h3-6H,1-2H3;4-6H,1-3H2 |
| InChIKey | IZKVMZBUIFGKPI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |