C39H43FN2O4 — CID 142175363
2-methoxyethyl 2-[4-[4-[[2-[4-(2-fluorobutan-2-yl)phenyl]benzoyl]amino]phenyl]piperidin-1-yl]-2-phenylacetate (PubChem CID 142175363) has the molecular formula C39H43FN2O4 and a molecular weight of 622.78 g/mol. Its IUPAC name is 2-methoxyethyl 2-[4-[4-[[2-[4-(2-fluorobutan-2-yl)phenyl]benzoyl]amino]phenyl]piperidin-1-yl]-2-phenylacetate.
| Compound Name | 2-methoxyethyl 2-[4-[4-[[2-[4-(2-fluorobutan-2-yl)phenyl]benzoyl]amino]phenyl]piperidin-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 142175363 |
| Molecular Formula | C39H43FN2O4 |
| Molecular Weight | 622.78 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | 2-methoxyethyl 2-[4-[4-[[2-[4-(2-fluorobutan-2-yl)phenyl]benzoyl]amino]phenyl]piperidin-1-yl]-2-phenylacetate |
| SMILES | CCC(C)(F)c1ccc(-c2ccccc2C(=O)Nc2ccc(C3CCN(C(C(=O)OCCOC)c4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C39H43FN2O4/c1-4-39(2,40)32-18-14-30(15-19-32)34-12-8-9-13-35(34)37(43)41-33-20-16-28(17-21-33)29-22-24-42(25-23-29)36(31-10-6-5-7-11-31)38(44)46-27-26-45-3/h5-21,29,36H,4,22-27H2,1-3H3,(H,41,43) |
| InChIKey | KOAQHRUMFSCAES-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.78 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|