About 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine
2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine (PubChem CID 142175548) has the molecular formula C13H22N4O2
and a molecular weight of 266.35 g/mol. Its IUPAC name is 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine |
| PubChem CID | 142175548 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine |
| SMILES | CN1C=CNC1N.COc1cc(N)c(OC)cc1C |
| InChI | InChI=1S/C9H13NO2.C4H9N3/c1-6-4-9(12-3)7(10)5-8(6)11-2;1-7-3-2-6-4(7)5/h4-5H,10H2,1-3H3;2-4,6H,5H2,1H3 |
| InChIKey | UGNMLXVLLUYQCT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine?
The IUPAC name of 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine (CID 142175548) is 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine.
What is the SMILES notation for 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine?
The canonical SMILES for 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine is CN1C=CNC1N.COc1cc(N)c(OC)cc1C.
What is the InChIKey of 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine?
The InChIKey is UGNMLXVLLUYQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2.C4H9N3/c1-6-4-9(12-3)7(10)5-8(6)11-2;1-7-3-2-6-4(7)5/h4-5H,10H2,1-3H3;2-4,6H,5H2,1H3.
What are the key properties of 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine?
2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine has a molecular weight of 266.35 g/mol, XLogP of 0.83, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxy-4-methylaniline;3-methyl-1,2-dihydroimidazol-2-amine is sourced from PubChem (CID 142175548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).