C31H47NO5 — CID 142176137
3-[3-[[[(2E,4E)-2-ethenyl-3-methyl-5-propoxyhepta-2,4-dienoyl]amino]methyl]-2,5-dimethyl-4-propylphenyl]-2-propan-2-yloxypropanoic acid (PubChem CID 142176137) has the molecular formula C31H47NO5 and a molecular weight of 513.72 g/mol. Its IUPAC name is 3-[3-[[[(2E,4E)-2-ethenyl-3-methyl-5-propoxyhepta-2,4-dienoyl]amino]methyl]-2,5-dimethyl-4-propylphenyl]-2-propan-2-yloxypropanoic acid.
| Compound Name | 3-[3-[[[(2E,4E)-2-ethenyl-3-methyl-5-propoxyhepta-2,4-dienoyl]amino]methyl]-2,5-dimethyl-4-propylphenyl]-2-propan-2-yloxypropanoic acid |
|---|---|
| PubChem CID | 142176137 |
| Molecular Formula | C31H47NO5 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.35 |
| IUPAC Name | 3-[3-[[[(2E,4E)-2-ethenyl-3-methyl-5-propoxyhepta-2,4-dienoyl]amino]methyl]-2,5-dimethyl-4-propylphenyl]-2-propan-2-yloxypropanoic acid |
| SMILES | C=C/C(C(=O)NCc1c(C)c(CC(OC(C)C)C(=O)O)cc(C)c1CCC)=C(C)\C=C(/CC)OCCC |
| InChI | InChI=1S/C31H47NO5/c1-10-14-27-21(7)16-24(18-29(31(34)35)37-20(5)6)23(9)28(27)19-32-30(33)26(13-4)22(8)17-25(12-3)36-15-11-2/h13,16-17,20,29H,4,10-12,14-15,18-19H2,1-3,5-9H3,(H,32,33)(H,34,35)/b25-17+,26-22+ |
| InChIKey | ZQSPILUIHIZKFJ-DLQZOSDBSA-N |
| XLogP | 6.52 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|