About (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol
(2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol (PubChem CID 142176183) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol |
| PubChem CID | 142176183 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol |
| SMILES | CCCC/C(C)=C/C=C(/CO)NC |
| InChI | InChI=1S/C11H21NO/c1-4-5-6-10(2)7-8-11(9-13)12-3/h7-8,12-13H,4-6,9H2,1-3H3/b10-7+,11-8- |
| InChIKey | QXNSUBJWUXPPRG-WAKDDQPJSA-N |
| XLogP | 2.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol?
The IUPAC name of (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol (CID 142176183) is (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol.
What is the SMILES notation for (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol?
The canonical SMILES for (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol is CCCC/C(C)=C/C=C(/CO)NC.
What is the InChIKey of (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol?
The InChIKey is QXNSUBJWUXPPRG-WAKDDQPJSA-N. The full InChI is InChI=1S/C11H21NO/c1-4-5-6-10(2)7-8-11(9-13)12-3/h7-8,12-13H,4-6,9H2,1-3H3/b10-7+,11-8-.
What are the key properties of (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol?
(2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol has a molecular weight of 183.29 g/mol, XLogP of 2.22, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-5-methyl-2-(methylamino)nona-2,4-dien-1-ol is sourced from PubChem (CID 142176183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).