C33H42ClN5O2 — CID 142176490
N-[[3-[(2-amino-5-butylphenyl)methyl]imidazo[1,2-a]pyridin-2-yl]methyl]-2-chloro-3,4-dimethoxy-N-(3-methylbutyl)benzenecarboximidamide (PubChem CID 142176490) has the molecular formula C33H42ClN5O2 and a molecular weight of 576.19 g/mol. Its IUPAC name is N-[[3-[(2-amino-5-butylphenyl)methyl]imidazo[1,2-a]pyridin-2-yl]methyl]-2-chloro-3,4-dimethoxy-N-(3-methylbutyl)benzenecarboximidamide.
| Compound Name | N-[[3-[(2-amino-5-butylphenyl)methyl]imidazo[1,2-a]pyridin-2-yl]methyl]-2-chloro-3,4-dimethoxy-N-(3-methylbutyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 142176490 |
| Molecular Formula | C33H42ClN5O2 |
| Molecular Weight | 576.19 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | N-[[3-[(2-amino-5-butylphenyl)methyl]imidazo[1,2-a]pyridin-2-yl]methyl]-2-chloro-3,4-dimethoxy-N-(3-methylbutyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\c1ccc(OC)c(OC)c1Cl)N(CCC(C)C)Cc1nc2ccccn2c1Cc1cc(CCCC)ccc1N |
| InChI | InChI=1S/C33H42ClN5O2/c1-6-7-10-23-12-14-26(35)24(19-23)20-28-27(37-30-11-8-9-17-39(28)30)21-38(18-16-22(2)3)33(36)25-13-15-29(40-4)32(41-5)31(25)34/h8-9,11-15,17,19,22,36H,6-7,10,16,18,20-21,35H2,1-5H3/b36-33+ |
| InChIKey | DMRPZYCIZDFJQC-PKUSAGTQSA-N |
| XLogP | 7.39 |
| TPSA | 88.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.19 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|