C32H45N7O — CID 142176619
1-butyl-3-[4-[1-(2,5-dimethylcyclohepta-1,4,6-trien-1-yl)oxyethenylamino]phenyl]pyrazolo[3,4-d]pyrimidin-4-amine;N,N-dimethylbutan-1-amine (PubChem CID 142176619) has the molecular formula C32H45N7O and a molecular weight of 543.76 g/mol. Its IUPAC name is 1-butyl-3-[4-[1-(2,5-dimethylcyclohepta-1,4,6-trien-1-yl)oxyethenylamino]phenyl]pyrazolo[3,4-d]pyrimidin-4-amine;N,N-dimethylbutan-1-amine.
| Compound Name | 1-butyl-3-[4-[1-(2,5-dimethylcyclohepta-1,4,6-trien-1-yl)oxyethenylamino]phenyl]pyrazolo[3,4-d]pyrimidin-4-amine;N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 142176619 |
| Molecular Formula | C32H45N7O |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.37 |
| IUPAC Name | 1-butyl-3-[4-[1-(2,5-dimethylcyclohepta-1,4,6-trien-1-yl)oxyethenylamino]phenyl]pyrazolo[3,4-d]pyrimidin-4-amine;N,N-dimethylbutan-1-amine |
| SMILES | C=C(Nc1ccc(-c2nn(CCCC)c3ncnc(N)c23)cc1)OC1=C(C)CC=C(C)C=C1.CCCCN(C)C |
| InChI | InChI=1S/C26H30N6O.C6H15N/c1-5-6-15-32-26-23(25(27)28-16-29-26)24(31-32)20-10-12-21(13-11-20)30-19(4)33-22-14-8-17(2)7-9-18(22)3;1-4-5-6-7(2)3/h7-8,10-14,16,30H,4-6,9,15H2,1-3H3,(H2,27,28,29);4-6H2,1-3H3 |
| InChIKey | SVXWBKHZRSBIMN-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|