About 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one
4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one (PubChem CID 142177119) has the molecular formula C30H32N2O3
and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one.
Molecular Properties
| Compound Name | 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one |
| PubChem CID | 142177119 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one |
| SMILES | C#CC(=O)c1ccccc1.Cc1ccc(C(=O)NCC2CN(CCc3ccccc3)CCO2)cc1 |
| InChI | InChI=1S/C21H26N2O2.C9H6O/c1-17-7-9-19(10-8-17)21(24)22-15-20-16-23(13-14-25-20)12-11-18-5-3-2-4-6-18;1-2-9(10)8-6-4-3-5-7-8/h2-10,20H,11-16H2,1H3,(H,22,24);1,3-7H |
| InChIKey | PUZLXUCDTPJPHN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one?
The IUPAC name of 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one (CID 142177119) is 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one.
What is the SMILES notation for 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one?
The canonical SMILES for 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one is C#CC(=O)c1ccccc1.Cc1ccc(C(=O)NCC2CN(CCc3ccccc3)CCO2)cc1.
What is the InChIKey of 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one?
The InChIKey is PUZLXUCDTPJPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O2.C9H6O/c1-17-7-9-19(10-8-17)21(24)22-15-20-16-23(13-14-25-20)12-11-18-5-3-2-4-6-18;1-2-9(10)8-6-4-3-5-7-8/h2-10,20H,11-16H2,1H3,(H,22,24);1,3-7H.
What are the key properties of 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one?
4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one has a molecular weight of 468.60 g/mol, XLogP of 4.17, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[[4-(2-phenylethyl)morpholin-2-yl]methyl]benzamide;1-phenylprop-2-yn-1-one is sourced from PubChem (CID 142177119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).