About 6,7-dimethylquinazolin-4-amine;ethane
6,7-dimethylquinazolin-4-amine;ethane (PubChem CID 142177634) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 6,7-dimethylquinazolin-4-amine;ethane.
Molecular Properties
| Compound Name | 6,7-dimethylquinazolin-4-amine;ethane |
| PubChem CID | 142177634 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 6,7-dimethylquinazolin-4-amine;ethane |
| SMILES | CC.CC.Cc1cc2ncnc(N)c2cc1C |
| InChI | InChI=1S/C10H11N3.2C2H6/c1-6-3-8-9(4-7(6)2)12-5-13-10(8)11;2*1-2/h3-5H,1-2H3,(H2,11,12,13);2*1-2H3 |
| InChIKey | LFCBHHYJHKMIAF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethylquinazolin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethylquinazolin-4-amine;ethane?
The IUPAC name of 6,7-dimethylquinazolin-4-amine;ethane (CID 142177634) is 6,7-dimethylquinazolin-4-amine;ethane.
What is the SMILES notation for 6,7-dimethylquinazolin-4-amine;ethane?
The canonical SMILES for 6,7-dimethylquinazolin-4-amine;ethane is CC.CC.Cc1cc2ncnc(N)c2cc1C.
What is the InChIKey of 6,7-dimethylquinazolin-4-amine;ethane?
The InChIKey is LFCBHHYJHKMIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3.2C2H6/c1-6-3-8-9(4-7(6)2)12-5-13-10(8)11;2*1-2/h3-5H,1-2H3,(H2,11,12,13);2*1-2H3.
What are the key properties of 6,7-dimethylquinazolin-4-amine;ethane?
6,7-dimethylquinazolin-4-amine;ethane has a molecular weight of 233.36 g/mol, XLogP of 3.88, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethylquinazolin-4-amine;ethane is sourced from PubChem (CID 142177634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).