C9H10S2 — CID 142177882
5-ethenyl-2-methylbenzene-1,3-dithiol (PubChem CID 142177882) has the molecular formula C9H10S2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 5-ethenyl-2-methylbenzene-1,3-dithiol.
| Compound Name | 5-ethenyl-2-methylbenzene-1,3-dithiol |
|---|---|
| PubChem CID | 142177882 |
| Molecular Formula | C9H10S2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 5-ethenyl-2-methylbenzene-1,3-dithiol |
| SMILES | C=Cc1cc(S)c(C)c(S)c1 |
| InChI | InChI=1S/C9H10S2/c1-3-7-4-8(10)6(2)9(11)5-7/h3-5,10-11H,1H2,2H3 |
| InChIKey | HCQWIUDJCQPTHA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|