About 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane
3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane (PubChem CID 142177938) has the molecular formula C20H28N2O2
and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane.
Molecular Properties
| Compound Name | 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane |
| PubChem CID | 142177938 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane |
| SMILES | CCC.CCCC.O=c1nc2occc2cn1Cc1ccccc1 |
| InChI | InChI=1S/C13H10N2O2.C4H10.C3H8/c16-13-14-12-11(6-7-17-12)9-15(13)8-10-4-2-1-3-5-10;1-3-4-2;1-3-2/h1-7,9H,8H2;3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | NUXFVZAMFDHSOJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane?
The IUPAC name of 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane (CID 142177938) is 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane.
What is the SMILES notation for 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane?
The canonical SMILES for 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane is CCC.CCCC.O=c1nc2occc2cn1Cc1ccccc1.
What is the InChIKey of 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane?
The InChIKey is NUXFVZAMFDHSOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2.C4H10.C3H8/c16-13-14-12-11(6-7-17-12)9-15(13)8-10-4-2-1-3-5-10;1-3-4-2;1-3-2/h1-7,9H,8H2;3-4H2,1-2H3;3H2,1-2H3.
What are the key properties of 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane?
3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane has a molecular weight of 328.46 g/mol, XLogP of 5.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylfuro[2,3-d]pyrimidin-2-one;butane;propane is sourced from PubChem (CID 142177938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).