C29H30Cl3N5O6S — CID 142178079
carbamoyl 3-[[2-methylpropyl-[2-oxo-2-(4-phenyl-3-sulfamoylanilino)acetyl]amino]methyl]-2-(2,2,2-trichloroethyl)benzenecarboximidate (PubChem CID 142178079) has the molecular formula C29H30Cl3N5O6S and a molecular weight of 683.01 g/mol. Its IUPAC name is carbamoyl 3-[[2-methylpropyl-[2-oxo-2-(4-phenyl-3-sulfamoylanilino)acetyl]amino]methyl]-2-(2,2,2-trichloroethyl)benzenecarboximidate.
| Compound Name | carbamoyl 3-[[2-methylpropyl-[2-oxo-2-(4-phenyl-3-sulfamoylanilino)acetyl]amino]methyl]-2-(2,2,2-trichloroethyl)benzenecarboximidate |
|---|---|
| PubChem CID | 142178079 |
| Molecular Formula | C29H30Cl3N5O6S |
| Molecular Weight | 683.01 g/mol |
| Exact Mass | 681.10 |
| IUPAC Name | carbamoyl 3-[[2-methylpropyl-[2-oxo-2-(4-phenyl-3-sulfamoylanilino)acetyl]amino]methyl]-2-(2,2,2-trichloroethyl)benzenecarboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1cccc(CN(CC(C)C)C(=O)C(=O)Nc2ccc(-c3ccccc3)c(S(N)(=O)=O)c2)c1CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C29H30Cl3N5O6S/c1-17(2)15-37(16-19-9-6-10-22(25(33)43-28(34)40)23(19)14-29(30,31)32)27(39)26(38)36-20-11-12-21(18-7-4-3-5-8-18)24(13-20)44(35,41)42/h3-13,17,33H,14-16H2,1-2H3,(H2,34,40)(H,36,38)(H2,35,41,42)/b33-25- |
| InChIKey | KUTYZAYKEVLWLZ-IVQJCJPDSA-N |
| XLogP | 4.96 |
| TPSA | 185.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.01 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|