C9H13NS — CID 142178507
(3Z,5Z)-3-(ethylideneamino)hepta-1,3,5-triene-4-thiol (PubChem CID 142178507) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is (3Z,5Z)-3-(ethylideneamino)hepta-1,3,5-triene-4-thiol.
| Compound Name | (3Z,5Z)-3-(ethylideneamino)hepta-1,3,5-triene-4-thiol |
|---|---|
| PubChem CID | 142178507 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (3Z,5Z)-3-(ethylideneamino)hepta-1,3,5-triene-4-thiol |
| SMILES | C=CC(/N=C/C)=C(S)\C=C/C |
| InChI | InChI=1S/C9H13NS/c1-4-7-9(11)8(5-2)10-6-3/h4-7,11H,2H2,1,3H3/b7-4-,9-8-,10-6+ |
| InChIKey | DSLUHNYXUGHMEE-ARTBKZBTSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|