About 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate
5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate (PubChem CID 142178566) has the molecular formula C20H22ClN3O2S
and a molecular weight of 403.94 g/mol. Its IUPAC name is 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate.
Molecular Properties
| Compound Name | 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate |
| PubChem CID | 142178566 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate |
| SMILES | COC(C)=O.Cc1sc(-c2ccc(N(C)C)nc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3S.C3H6O2/c1-11-16(12-4-7-14(18)8-5-12)20-17(22-11)13-6-9-15(19-10-13)21(2)3;1-3(4)5-2/h4-10H,1-3H3;1-2H3 |
| InChIKey | VMSRPBQDXJDPLX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate?
The IUPAC name of 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate (CID 142178566) is 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate.
What is the SMILES notation for 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate?
The canonical SMILES for 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate is COC(C)=O.Cc1sc(-c2ccc(N(C)C)nc2)nc1-c1ccc(Cl)cc1.
What is the InChIKey of 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate?
The InChIKey is VMSRPBQDXJDPLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3S.C3H6O2/c1-11-16(12-4-7-14(18)8-5-12)20-17(22-11)13-6-9-15(19-10-13)21(2)3;1-3(4)5-2/h4-10H,1-3H3;1-2H3.
What are the key properties of 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate?
5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate has a molecular weight of 403.94 g/mol, XLogP of 5.08, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-N,N-dimethylpyridin-2-amine;methyl acetate is sourced from PubChem (CID 142178566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).