About 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile
4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 142179315) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 142179315 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | CC(C)(C)CCCNC1=CC=C(C#N)CC1 |
| InChI | InChI=1S/C14H22N2/c1-14(2,3)9-4-10-16-13-7-5-12(11-15)6-8-13/h5,7,16H,4,6,8-10H2,1-3H3 |
| InChIKey | ZTMKCFFJGGSZIT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile (CID 142179315) is 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile is CC(C)(C)CCCNC1=CC=C(C#N)CC1.
What is the InChIKey of 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is ZTMKCFFJGGSZIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2/c1-14(2,3)9-4-10-16-13-7-5-12(11-15)6-8-13/h5,7,16H,4,6,8-10H2,1-3H3.
What are the key properties of 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile?
4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 218.34 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylpentylamino)cyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 142179315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).